5-fluoro-1-methylindole-3-carbaldehyde
Catalog No: FT-0711397
CAS No: 441715-30-6
- Chemical Name: 5-fluoro-1-methylindole-3-carbaldehyde
- Molecular Formula: C10H8FNO
- Molecular Weight: 177.17
- InChI Key: ZBZJEWSFESAGMQ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8FNO/c1-12-5-7(6-13)9-4-8(11)2-3-10(9)12/h2-6H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 441715-30-6 |
|---|---|
| MF: | C10H8FNO |
| Density: | 1.2g/cm3 |
| Flash_Point: | 148.7ºC |
| Melting_Point: | N/A |
| Product_Name: | 5-fluoro-1-methylindole-3-carbaldehyde |
| Symbol: | GHS05 |
| Bolling_Point: | 322.3ºC at 760 mmHg |
| FW: | 177.17500 |
| Density: | 1.2g/cm3 |
|---|---|
| MF: | C10H8FNO |
| LogP: | 2.12990 |
| Exact_Mass: | 177.05900 |
| Bolling_Point: | 322.3ºC at 760 mmHg |
| Flash_Point: | 148.7ºC |
| FW: | 177.17500 |
| Refractive_Index: | 1.568 |
| PSA: | 22.00000 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H318 |
| Symbol: | GHS05 |
| Hazard_Codes: | Xi |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)